asdjaklskjturil asdjaklskjturil
  • 16-01-2018
  • Mathematics
contestada

how do you write the expression as an angle sin42cos17-cos42sin17

Respuesta :

Rod44 Rod44
  • 16-01-2018
sin(a+b)=sin(a)cos(b)+cos(a)sin(b).
Let a=42 and b=17 so sin(42+17)=sin59.
Answer Link

Otras preguntas

why did the church respond with its Catholic reformation
what is the wavelength of violet light that has a frequency of 7.5x10^14
Which hydrocarbon is saturated? (1) propene (3) butene(2) ethyne (4) heptane
how much physical activity should an adult have each week
what groups were in conflict in the south?
based on your knowledge of different works of literature, which two stories seem to have similar general themes? A the interlopers and by the water of Babylon b
Two spherical balloons are filled with water. The first balloon has a radius of 3 cm, and the second has a radius of 6 cm. How much more water is in the larger
what article, section, and clause states how long a person's term in the supreme court can be?
What is the molecular formula of a compound that has a molecular mass of 54 and the empirical formula C2H3? A. C2H3 B. C4H6 C. C6H9 D. C8H12
In 1933, COngress repealed Prohibition with the A. Eighteenth AMendment B. Nineteenth Amendment C. Twentieth Amendment D. Twenty-first Amendment