melissaurias27 melissaurias27

16-01-2018
Mathematics

contestada

What is the name of the line that you use to define parbola

Respuesta :

LearnGrow LearnGrow

16-01-2018

Directrix is the name of the line that you use to define parbola.

Vertex on the other hand is the point in which the y value is only used for one point on the parabola.

Answer Link

Otras preguntas

How do you assist a student who has been tardy to become punctual

A teacher weighed 145 lbs in 1986 and weighed 190 lbs in 2007. What was the average rate of change in weight? What does this mean in the context problem?

Who founded the Catholic Church

You take $150 you had kept under your mattress and deposit it in your bank account. Supposed this 150 stay in the banking stystem as reserves and bank hold rese

Who did ares disappear

Evaluate the use of hydrogen as a fuel. Explain how hydrogen is produced. Write about the environmental impact of using diesel and petrol. (pls include info on

The volume of a sphere is 904.32 cm3, find its radius and hence its curved surface area

If a = 4 units, b = 7 units, c = 8 units, d = 11 units, and e = 5 units, what is the volume of the composite figure?

cosec(6b+pi/8)=sec(2b-pi/8)

The diagram shows the molecular structure of adenosine triphosphate (ATP) The diagram shows a three-part structure. From left to right, adenine is shown as two