madisonkhailey madisonkhailey

14-03-2017
Mathematics

contestada

An insect is 3 inches long. What is the length to the nearest hundredth of a centimeter

Respuesta :

Аноним Аноним

14-03-2017

1 inch = 2.54 cm
3 inches = 3 * 2.54 = 7.62 cm

Answer Link

Otras preguntas

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

Pls help. Answer the question in the picture. I will give a thanks, 5 stars, and finally: BRAINLIEST! *20 POINTS*

In the reaction 2KC1(e) → 2K(s) + Cl₂(g), the K+ ions are (1) reduced by losing electrons (2) reduced by gaining electrons (3) oxidized by losing electrons (4)

Lina picks a 4 digit number. The number is more than 5000. The number is odd. The second digit is a prime number. How many different possible numbers could Lina

Describe the role of lignin in plants.

What are monuments ? pleases help who will answer first I will make him/her brainless sorry sorry brainlist

can someone please explain how i do this

The results of a series of surveys revealed a population with a mean of 4.73 and a standard deviation of 0.865. If each survey has a sample size of 200, which v

Find the 30% out of 175

Answer this question please