sandovalsandra069 sandovalsandra069

13-11-2021
Mathematics

contestada

Mary is doing research on bird migration. Last week she counted 12 migration birds in her yard. This week she counted 10. What was the percent decrease in birds this week?

Respuesta :

joycezhang776 joycezhang776

13-11-2021

16.67% decrease in birds per weeks

Answer Link

Otras preguntas

Dora is a homeless person living on the streets of downtown baltimore most motivated by:______.

If you have actually experienced something, your attitude toward it is __________ your behavior

Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh

to become the sun and the moon What is the most likely reason that Nanahuatzin jumped into the fire first? He grew impatient with Tecuciztecatl. He wanted to s

As filtrate moves down the loop of henle, the surrounding interstitial fluid becomes _____ concentrated than the filtrate, so _____ leaves the filtrate.

Acetophenone was treated by one equivalent of lda, followed by one equivalent of \it{tert}-butyl bromide. what are the most likely reaction products?

Find both the scalar projection compvuand the vector projection projvuof the vectoru=〈1,−1,1〉onto the vectorv=〈1,0,1〉. answer:. . . . . . . . . . . . . . . . .

How serious are the risks to your computer security? Why is it important to protect a Wi-Fi network? What should you do to protect your Wi-Fi network?

Find the absolute maximum and minimum values of the function, subject to the given constraints. k(x,y)=−x2−y2 4x 4y; 0≤x≤3, y≥0, and x y≤6

Find the taylor series for f(x) centered at the given value of a. [assume that f has a power series expansion. do not show that rn(x) → 0. ] f(x) = 8/x, a = −4