skyejoness37 skyejoness37

01-12-2020
Mathematics

contestada

Combine the like terms to create an equivalent expression.
5r + 15 - 2r - 5

Respuesta :

isavans isavans

01-12-2020

3r + 10 is the answer

Answer Link

Otras preguntas

Which of the following accurately describes how Netflix used innovation to gain a competitive advantage? A. Netflix moved from content development to upgrading

your aerobic zone is the heart rate range between 50-80% of your maximum heart rate.

write a polynomial function in standard form with the given zeros calculator

which of the following is a feature of an oligopoly?group of answer choicesthere are a large number of sellers in this firm in this market earns zero economic f

Which of the following is the keyboard command for "paste"?This question is required. * A Ctrl + V / Command + V B Ctrl + P / Command + P C Ctrl + C / Command +

consider the following reaction with rate law: a b -> c rate = k [a]1/2[b]2 what are the units of the rate constant, k?

which of the following is an example of a variable interval reinforcement schedule?

use the following figure for the federal funds market to answer the next question. if the fed supplies $200 billion in reserves, the equilibrium prime rate is

ch3ch2ch(c6h5)ch(ch3)ch2ch3spell out the full name of the compound.

how do light-colored igneous rocks differ from dark-colored rocks?