jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

why u sound your horn?

If the president should die or become unable to fulfill his role, what would be the correct order of those listed below in the "line of succession" to take offi

a particular amusement park ride will make 156 revolutions and 180 seconds at this rate how many revolutions will it make in 2 minutes

List five things in your class room that are matter

Why do some believe that real witched were behind the curse of macbeth in shakespeare?

Which best describes electrical energy? a. energy released by a chemical reaction b. energy produced by flow of electric charge c. energy released by nuclear re

How does the skin aid the immune system in maintaining homeostasis? A. Glands in the skin release acidic oils that prevent infection. B. Melanin in the skin

a 13.5-gallon gasoline tank is 4/5 full. How many gallons will it take to fill the tank?

James needs to clock in a minimum of 9 hours per day at work. However, the working hours that he records varies between 9 to 12 from day to day. His recorded wo

What is the structure of this document? A. Q&A (FAQ) B. fill-in-the-blank C. instruction page D. checklist