pickleglocck pickleglocck

11-06-2020
Mathematics

contestada

find an angle x where sin x = cos x (I know this has been answered but I rlly don't get it..)

Respuesta :

yeetosaurus69 yeetosaurus69

11-06-2020

Answer:

45 degrees

Step-by-step explanation:

sin x=cos(90-x)

sin(45)=cos(90-45)=cos(45)

Answer Link

udhayabrol udhayabrol

26-07-2020

Answer:

The answer is 45.

sin45=cos45= 1/√2.

hope it helps u ...

Answer Link

Otras preguntas

The electrons generated from the Krebs cycle are transferred to ____________ and then are _______________.

The product of the synthesis reaction between sodium and chlorine gas is ?

Jill traveled to Canada and bought a new lamp for $460 Canadian dollars. In US dollars (to the nearest cent) this is equivalent to? A) $517.77 B) $450.52 C) $57

Jill traveled to Canada and bought a new lamp for $460 Canadian dollars. In US dollars (to the nearest cent) this is equivalent to? A) $517.77 B) $450.52 C) $57

Many historians believe the leading motive for the War of 1812 was the western desire for land expansion. True or false??

How did the United States persuade Japanese leaders to sign a trade treaty ?

Why are leaves green?

Horatio wants to ship a batch of 8 machine parts. The packaging for each part weighs 2 pounds. If each part weighs x pounds, which expression represents the tot

Horace Bushnell is associated with which idea? a.religious liberalism b.religious fundamentalism c.religious intolerance d.religious liberty

from y^2+5y-7 subtract y^2-3y-4